cas: 603124-78-3 — see every product listed under this CAS number, including other names
Methyl 2,3-dichloroisonicotinate 95% (CAS 603124-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120876-100mg |
| cas | 603124-78-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 359.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A120876 |
Methyl 2,3-dichloropyridine-4-carboxylate (CAS 603124-78-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 2,3-dichloropyridine-4-carboxylate. InChIKey: PFAVUXBECIRJIY-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 2,3-dichloropyridine-4-carboxylate |
| InChIKey | PFAVUXBECIRJIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NC=C1)Cl)Cl |
Computed by PubChem (NCBI)