cas: 213670-35-0 — see every product listed under this CAS number, including other names
Methyl 2,3-dioxoindoline-6-carboxylate, 97%, 97% (CAS 213670-35-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CG16-1g |
| cas | 213670-35-0 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 731.60 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 285.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dioxo-1H-indole-6-carboxylate (CAS 213670-35-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: methyl 2,3-dioxo-1H-indole-6-carboxylate. InChIKey: WUSOZUAKIZDOTD-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | methyl 2,3-dioxo-1H-indole-6-carboxylate |
| InChIKey | WUSOZUAKIZDOTD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)