cas: 1059195-96-8 — see every product listed under this CAS number, including other names
Methyl 2-(1,3-dioxo-1,2,3,4-tetrahydropyrrolo(1,2-a)pyrazin-4-yl)acetate, 97% (CAS 1059195-96-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A163027-5g |
| cas | 1059195-96-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 29436.61 Pln | |
| AmBeed | 250mg | 5063.17 Pln | |
| AmBeed | 1g | 8448.37 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate (CAS 1059195-96-8) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate. InChIKey: DYPKUMVHMDDLOH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | methyl 2-(1,3-dioxo-4H-pyrrolo[1,2-a]pyrazin-4-yl)acetate |
| InChIKey | DYPKUMVHMDDLOH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1C(=O)NC(=O)C2=CC=CN12 |
Computed by PubChem (NCBI)