Methyl 2-(aminomethyl)-5-bromobenzoate hydrochloride, 97%
cas: 1638487-45-2 — see every product listed under this CAS number, including other names
Methyl 2-(aminomethyl)-5-bromobenzoate hydrochloride, 97% (CAS 1638487-45-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A156551-250mg |
| cas | 1638487-45-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 859.88 Pln | |
| Ambeed | 5g | 2895.75 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2906.00 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 919.70 Pln | |
| BLDpharm | 5g | 3118.93 Pln | |
| Fluorochem | 5g | 5386.66 Pln | |
| Fluorochem | 250mg | 653.95 Pln | |
| Fluorochem | 1g | 1591.12 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride (CAS 1638487-45-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride. InChIKey: TUTVUTQEKMXMIK-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride |
| InChIKey | TUTVUTQEKMXMIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)CN.Cl |
Computed by PubChem (NCBI)