Products 1638487-45-2
CAS 1638487-45-2 appears in our catalog under these names: Methyl 2-(aminomethyl)-5-bromobenzoate hydrochloride, ≥97%, Methyl 2-(aminomethyl)-5-bromobenzoate hydrochloride, 97%, Methyl 2-(aminomethyl)-5-bromobenzoate hydrochloride, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride (CAS 1638487-45-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride. InChIKey: TUTVUTQEKMXMIK-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 2-(aminomethyl)-5-bromobenzoate;hydrochloride |
| InChIKey | TUTVUTQEKMXMIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)CN.Cl |
Computed by PubChem (NCBI)