cas: 914106-36-8 — see every product listed under this CAS number, including other names
Methyl 2-chloro-5-cyanobenzoate, 97% (CAS 914106-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F454153-100MG |
| cas | 914106-36-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 2418.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-chloro-5-cyanobenzoate (CAS 914106-36-8) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 2-chloro-5-cyanobenzoate. InChIKey: RGLQGCVEXOWXEK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 2-chloro-5-cyanobenzoate |
| InChIKey | RGLQGCVEXOWXEK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)Cl |
Computed by PubChem (NCBI)