cas: 84832-02-0 — see every product listed under this CAS number, including other names
Methyl 3-Amino-2,6-Difluorobenzoate, 98%, 98% (CAS 84832-02-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115N5L-1g |
| cas | 84832-02-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 429.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-2,6-difluorobenzoate (CAS 84832-02-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 3-amino-2,6-difluorobenzoate. InChIKey: IUXHGFLADBGDTR-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 3-amino-2,6-difluorobenzoate |
| InChIKey | IUXHGFLADBGDTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)N)F |
Computed by PubChem (NCBI)