cas: 1378875-92-3 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2,6-difluorobenzoate 98% (CAS 1378875-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108334-100mg |
| cas | 1378875-92-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 820.94 Pln | |
| Ambeed | 10g | 1382.75 Pln | |
| Ambeed | 25g | 2701.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108334 |
Methyl 3-bromo-2,6-difluorobenzoate (CAS 1378875-92-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,6-difluorobenzoate. InChIKey: FDVRSJQCIUFAKY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | FDVRSJQCIUFAKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)