cas: 1378875-92-3 — see every product listed under this CAS number, including other names
METHYL 3-BROMO-2,6-DIFLUOROBENZOATE, 98% (CAS 1378875-92-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472137-250MG |
| cas | 1378875-92-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 25g | 2658.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-bromo-2,6-difluorobenzoate (CAS 1378875-92-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,6-difluorobenzoate. InChIKey: FDVRSJQCIUFAKY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | FDVRSJQCIUFAKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)