cas: 108249-43-0 — see every product listed under this CAS number, including other names
Methyl 3-bromo-4-hydroxy-5-methoxybenzoate 97% (CAS 108249-43-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A804191-250mg |
| cas | 108249-43-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1443.94 Pln | |
| Ambeed | 10g | 2361.75 Pln | |
| Ambeed | 25g | 4675.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A804191 |
Methyl 3-bromo-4-hydroxy-5-methoxybenzoate (CAS 108249-43-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: methyl 3-bromo-4-hydroxy-5-methoxybenzoate. InChIKey: UIWBPQDQVILUJA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | methyl 3-bromo-4-hydroxy-5-methoxybenzoate |
| InChIKey | UIWBPQDQVILUJA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)OC)Br)O |
Computed by PubChem (NCBI)