Products 350035-53-9

CAS 350035-53-9 is the registry number for Ethyl 4-bromo-3,5-dihydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-bromo-3,5-dihydroxybenzoate (CAS 350035-53-9) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: ethyl 4-bromo-3,5-dihydroxybenzoate. InChIKey: ZNJKJGZYGTUKKM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO4
Molecular weight261.07 g/mol
IUPAC nameethyl 4-bromo-3,5-dihydroxybenzoate
InChIKeyZNJKJGZYGTUKKM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C(=C1)O)Br)O

Computed by PubChem (NCBI)