CAS 350035-53-9 is the registry number for Ethyl 4-bromo-3,5-dihydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4-bromo-3,5-dihydroxybenzoate (CAS 350035-53-9) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: ethyl 4-bromo-3,5-dihydroxybenzoate. InChIKey: ZNJKJGZYGTUKKM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | ethyl 4-bromo-3,5-dihydroxybenzoate |
| InChIKey | ZNJKJGZYGTUKKM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)O)Br)O |
Computed by PubChem (NCBI)