cas: 108249-43-0 — see every product listed under this CAS number, including other names
Methyl 3-bromo-4-hydroxy-5-methoxybenzoate, 97%, 97% (CAS 108249-43-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118V60-250mg |
| cas | 108249-43-0 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1115.60 Pln | |
| Chemat | 10g | 1821.20 Pln | |
| Chemat | 25g | 3592.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-4-hydroxy-5-methoxybenzoate (CAS 108249-43-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: methyl 3-bromo-4-hydroxy-5-methoxybenzoate. InChIKey: UIWBPQDQVILUJA-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | methyl 3-bromo-4-hydroxy-5-methoxybenzoate |
| InChIKey | UIWBPQDQVILUJA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)OC)Br)O |
Computed by PubChem (NCBI)