CAS 72517-23-8 appears in our catalog under these names: 5-Bromo-2,3-dimethoxybenzoic acid, 97%, 5-Bromo-2,3-dimethoxybenzoic acid, 98%, 5–Bromo–2,3–dimethoxybenzoic acid, 5-Bromo-2,3-dimethoxybenzoic acid, 5-Bromo-2,3-dimethoxybenzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg.
5-bromo-2,3-dimethoxybenzoic acid (CAS 72517-23-8) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 5-bromo-2,3-dimethoxybenzoic acid. InChIKey: ZKMWQUDSDYOEJQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 5-bromo-2,3-dimethoxybenzoic acid |
| InChIKey | ZKMWQUDSDYOEJQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)O)Br |
Computed by PubChem (NCBI)