CAS 17275-86-4 appears in our catalog under these names: 2-Bromo-3,5-dimethoxy-benzoic acid, 95%, 2-Bromo-3,5-dimethoxybenzoic Acid. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-bromo-3,5-dimethoxybenzoic acid (CAS 17275-86-4) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-bromo-3,5-dimethoxybenzoic acid. InChIKey: WZYHIVYNECVLKT-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-bromo-3,5-dimethoxybenzoic acid |
| InChIKey | WZYHIVYNECVLKT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)Br)C(=O)O |
Computed by PubChem (NCBI)