Products 35458-39-0
CAS 35458-39-0 appears in our catalog under these names: 4-Bromo-2,5-dimethoxybenzoic acid, 95%, 4-Bromo-2,5-dimethoxybenzoic acid, 4-Bromo-2,5-dimethoxybenzoic acid 97%, 4-Bromo-2,5-dimethoxybenzoic acid, 97%, 97%, 4-Bromo-2,5-dimethoxybenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 0,5g, 100mg, 500mg.
4-bromo-2,5-dimethoxybenzoic acid (CAS 35458-39-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 4-bromo-2,5-dimethoxybenzoic acid. InChIKey: LNIJFUCQBPDEIV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 4-bromo-2,5-dimethoxybenzoic acid |
| InChIKey | LNIJFUCQBPDEIV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)OC)Br |
Computed by PubChem (NCBI)