CAS 2244107-75-1 is the registry number for 5-Bromo-3-(methoxymethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-bromo-5-(methoxymethoxy)benzoic acid (CAS 2244107-75-1) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 3-bromo-5-(methoxymethoxy)benzoic acid. InChIKey: NYGFRNRZULHUNP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 3-bromo-5-(methoxymethoxy)benzoic acid |
| InChIKey | NYGFRNRZULHUNP-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)