Products 2244107-75-1

CAS 2244107-75-1 is the registry number for 5-Bromo-3-(methoxymethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-5-(methoxymethoxy)benzoic acid (CAS 2244107-75-1) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 3-bromo-5-(methoxymethoxy)benzoic acid. InChIKey: NYGFRNRZULHUNP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO4
Molecular weight261.07 g/mol
IUPAC name3-bromo-5-(methoxymethoxy)benzoic acid
InChIKeyNYGFRNRZULHUNP-UHFFFAOYSA-N
SMILESCOCOC1=CC(=CC(=C1)C(=O)O)Br

Computed by PubChem (NCBI)