CAS 1312609-83-8 appears in our catalog under these names: Ethyl 4-bromo-2,3-dihydroxybenzoate, 95%, Ethyl 4-bromo-2,3-dihydroxybenzoate, 95%, 95%, Ethyl 4-bromo-2,3-dihydroxybenzoate, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
Ethyl 4-bromo-2,3-dihydroxybenzoate (CAS 1312609-83-8) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: ethyl 4-bromo-2,3-dihydroxybenzoate. InChIKey: PSZXIAXXYJBWNW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | ethyl 4-bromo-2,3-dihydroxybenzoate |
| InChIKey | PSZXIAXXYJBWNW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)Br)O)O |
Computed by PubChem (NCBI)