Products 68545-92-6

CAS 68545-92-6 is the registry number for 2-(3-Bromo-4-methoxyphenoxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(3-bromo-4-methoxyphenoxy)acetic acid (CAS 68545-92-6) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-(3-bromo-4-methoxyphenoxy)acetic acid. InChIKey: HVOVLFALHLFGAF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO4
Molecular weight261.07 g/mol
IUPAC name2-(3-bromo-4-methoxyphenoxy)acetic acid
InChIKeyHVOVLFALHLFGAF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)OCC(=O)O)Br

Computed by PubChem (NCBI)