Methyl 3-chloro-4-cyanobenzoate, 98%
cas: 214759-66-7 — see every product listed under this CAS number, including other names
Methyl 3-chloro-4-cyanobenzoate, 98% (CAS 214759-66-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A394089-250mg |
| cas | 214759-66-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2929.12 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 736.40 Pln | |
| Chemat | 5g | 2939.60 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 3152.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-chloro-4-cyanobenzoate (CAS 214759-66-7) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 3-chloro-4-cyanobenzoate. InChIKey: KDNFJYKKFLHZKZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 3-chloro-4-cyanobenzoate |
| InChIKey | KDNFJYKKFLHZKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)