cas: 883-99-8 — see every product listed under this CAS number, including other names
Methyl 3-hydroxy-2-naphthoate, 98%(GC-MS), 98%(GC-MS) (CAS 883-99-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RSC-25g |
| cas | 883-99-8 |
| size | 25g |
| availability | 185g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 251.60 Pln |
| purity | 98%(GC-MS) |
|---|---|
| delivery time | 3 weeks |
Methyl 3-hydroxynaphthalene-2-carboxylate (CAS 883-99-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: YVVBECLPRBAATK-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 3-hydroxynaphthalene-2-carboxylate |
| InChIKey | YVVBECLPRBAATK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC=CC=C2C=C1O |
Computed by PubChem (NCBI)