Methyl 4-amino-2,3-dichlorobenzoate, 98%
cas: 1807013-25-7 — see every product listed under this CAS number, including other names
Methyl 4-amino-2,3-dichlorobenzoate, 98% (CAS 1807013-25-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg, 100mg. Offered by: Ambeed, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A986644-250mg |
| cas | 1807013-25-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1549.62 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 500mg | 247.85 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1309.97 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 1669.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-amino-2,3-dichlorobenzoate (CAS 1807013-25-7) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 4-amino-2,3-dichlorobenzoate. InChIKey: GRCMPRIJWCTEMT-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 4-amino-2,3-dichlorobenzoate |
| InChIKey | GRCMPRIJWCTEMT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)Cl)Cl |
Computed by PubChem (NCBI)