cas: 130613-19-3 — see every product listed under this CAS number, including other names
Methyl 5,7-dichloro-4-hydroxyquinoline-2-carboxylate, 95%, 95% (CAS 130613-19-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UP3-250mg |
| cas | 130613-19-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 1955.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate (CAS 130613-19-3) is a chemical compound with the molecular formula C11H7Cl2NO3 and a molecular weight of 272.08 g/mol. IUPAC name: methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: DNQDFGYHUHRIHR-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO3 |
|---|---|
| Molecular weight | 272.08 g/mol |
| IUPAC name | methyl 5,7-dichloro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | DNQDFGYHUHRIHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)