cas: 39503-52-1 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-hydroxy-4-methoxybenzoate, 98%, 98% (CAS 39503-52-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CHBY-100mg |
| cas | 39503-52-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 981.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-2-hydroxy-4-methoxybenzoate (CAS 39503-52-1) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: methyl 5-bromo-2-hydroxy-4-methoxybenzoate. InChIKey: WLCVGKZBHDBQJN-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | methyl 5-bromo-2-hydroxy-4-methoxybenzoate |
| InChIKey | WLCVGKZBHDBQJN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)O)C(=O)OC)Br |
Computed by PubChem (NCBI)