CAS 181517-98-6 is the registry number for 2-Bromo-4-hydroxy-5-methoxyphenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-(2-bromo-4-hydroxy-5-methoxyphenyl)acetic acid (CAS 181517-98-6) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 2-(2-bromo-4-hydroxy-5-methoxyphenyl)acetic acid. InChIKey: WXCVKEBRBISILO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 2-(2-bromo-4-hydroxy-5-methoxyphenyl)acetic acid |
| InChIKey | WXCVKEBRBISILO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)O)Br)O |
Computed by PubChem (NCBI)