cas: 1219198-88-5 — see every product listed under this CAS number, including other names
Methyl amino(3-bromophenyl)acetate hydrochloride, 97% (CAS 1219198-88-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046559-500MG |
| cas | 1219198-88-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 825.77 Pln | |
| Fluorochem | 1g | 1205.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride (CAS 1219198-88-5) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride. InChIKey: UYQXPUQVLSXOMR-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride |
| InChIKey | UYQXPUQVLSXOMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)