cas: 405878-98-0 — see every product listed under this CAS number, including other names
N-Benzyl-2,2,2-trifluoroethanamine hydrochloride, 97% (CAS 405878-98-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763117-250MG |
| cas | 405878-98-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1247.50 Pln | |
| Fluorochem | 500mg | 1841.04 Pln | |
| Fluorochem | 1g | 2720.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N-benzyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 405878-98-0) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: N-benzyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: GOZGAFVDXDYLRF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | N-benzyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | GOZGAFVDXDYLRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(F)(F)F.Cl |
Computed by PubChem (NCBI)