cas: 1263378-01-3 — see every product listed under this CAS number, including other names
N-Methyl-4-(methylsulfonyl)aniline, HCl, 97%, 97% (CAS 1263378-01-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111SNL-250mg |
| cas | 1263378-01-3 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1614.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-methyl-4-methylsulfonylaniline;hydrochloride (CAS 1263378-01-3) is a chemical compound with the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. IUPAC name: N-methyl-4-methylsulfonylaniline;hydrochloride. InChIKey: JLMAKOFZASQMNU-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNO2S |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | N-methyl-4-methylsulfonylaniline;hydrochloride |
| InChIKey | JLMAKOFZASQMNU-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)