N4,N4'-Diphenyl-[1,1'-biphenyl]-4,4'-diamine, 98%
cas: 531-91-9 — see every product listed under this CAS number, including other names
N4,N4'-Diphenyl-[1,1'-biphenyl]-4,4'-diamine, 98% (CAS 531-91-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A800662-1g |
| cas | 531-91-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 921.06 Pln | |
| Ambeed | 500g | 3045.94 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 281.04 Pln | |
| BLDpharm | 100g | 903.04 Pln | |
| BLDpharm | 500g | 2985.64 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-anilinophenyl)-N-phenylaniline (CAS 531-91-9) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-(4-anilinophenyl)-N-phenylaniline. InChIKey: FDRNXKXKFNHNCA-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-(4-anilinophenyl)-N-phenylaniline |
| InChIKey | FDRNXKXKFNHNCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
N,N'-Diphenylbenzidine, N4,N4'-Diphenyl-[1,1'-biphenyl]-4,4'-diamine, Diphenylbenzidine, Benzidine, N,N'-diphenyl-, [1,1'-Biphenyl]-4,4'-diamine, N,N'-diphenyl-, N,N-Diphenylbenzidine, (1,1'-Biphenyl)-4,4'-diamine, N,N'-diphenyl-, N,N'-DIPHENYLBENZIDINE [MI], N(4),N(4')-Diphenyl-biphenyl-4,4'-diamine, Benzidine, N,N'diphenyl