CAS 632-52-0 appears in our catalog under these names: 1,1,2,2-Tetraphenylhydrazine, 95%, 95%, 1,1,2,2-Tetraphenylhydrazine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,1,2,2-tetraphenylhydrazine (CAS 632-52-0) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 1,1,2,2-tetraphenylhydrazine. InChIKey: KRMMZNOTUOIFQX-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 1,1,2,2-tetraphenylhydrazine |
| InChIKey | KRMMZNOTUOIFQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)