CAS 19606-98-5 appears in our catalog under these names: N,N,N'-Triphenyl-1,4-phenylenediamine, 98%, 4-Anilinotriphenylamine, 95%, N,N,N'–Triphenyl–1,4–phenylenediamine, N,N,N'-Triphenyl-1,4-phenylenediamine, >98.0%(GC), N1,N1,N4-Triphenylbenzene-1,4-diamine 95%. Offered by: Fluorochem, Combi-blocks, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 200mg.
1-N,4-N,4-N-triphenylbenzene-1,4-diamine (CAS 19606-98-5) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 1-N,4-N,4-N-triphenylbenzene-1,4-diamine. InChIKey: OCQFHFNWMCLWKC-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 1-N,4-N,4-N-triphenylbenzene-1,4-diamine |
| InChIKey | OCQFHFNWMCLWKC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)