Products 1554227-26-7
CAS 1554227-26-7 is the registry number for N1,N1,N3-Triphenylbenzene-1,3-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-N,3-N,3-N-triphenylbenzene-1,3-diamine (CAS 1554227-26-7) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 1-N,3-N,3-N-triphenylbenzene-1,3-diamine. InChIKey: SLWKZPBLYVPJKI-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 1-N,3-N,3-N-triphenylbenzene-1,3-diamine |
| InChIKey | SLWKZPBLYVPJKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=CC=C2)N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)