Products 2568147-04-4
CAS 2568147-04-4 is the registry number for 4,4'-((5-(tert-Butyl)-1,3-phenylene)bis(ethyne-2,1-diyl))dipyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-[3-tert-butyl-5-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine (CAS 2568147-04-4) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-[2-[3-tert-butyl-5-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine. InChIKey: BYFXCASCIVBSAW-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-[2-[3-tert-butyl-5-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine |
| InChIKey | BYFXCASCIVBSAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C#CC2=CC=NC=C2)C#CC3=CC=NC=C3 |
Computed by PubChem (NCBI)