CAS 53693-67-7 appears in our catalog under these names: (1,1':4',1'':4'',1'''–Quaterphenyl)–4,4'''–diamine, [1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-diamine, 98%, 98%, [1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-diamine, 95%, [1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-diamine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline (CAS 53693-67-7) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline. InChIKey: JZIAOTUERDUSJC-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-[4-[4-(4-aminophenyl)phenyl]phenyl]aniline |
| InChIKey | JZIAOTUERDUSJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)