CAS 16208-89-2 is the registry number for 2,6-Bis(4-methylphenyl)-4,4′-bipyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine (CAS 16208-89-2) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine. InChIKey: XWVASFZTYFAOSN-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine |
| InChIKey | XWVASFZTYFAOSN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC(=N2)C3=CC=C(C=C3)C)C4=CC=NC=C4 |
Computed by PubChem (NCBI)