CAS 86803-29-4 appears in our catalog under these names: 1-Trityl-4-vinyl-1H-imidazole, 1-Trityl-4-vinyl-1h-imidazole, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
4-ethenyl-1-tritylimidazole (CAS 86803-29-4) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-ethenyl-1-tritylimidazole. InChIKey: FMKDQHLJKQOFQV-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-ethenyl-1-tritylimidazole |
| InChIKey | FMKDQHLJKQOFQV-UHFFFAOYSA-N |
| SMILES | C=CC1=CN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)