CAS 918801-05-5 is the registry number for 4,4'–((2,3,5,6–Tetramethyl–1,4–phenylene)bis(ethyne–2,1–diyl))dipyridine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
4-[2-[2,3,5,6-tetramethyl-4-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine (CAS 918801-05-5) is a chemical compound with the molecular formula C24H20N2 and a molecular weight of 336.4 g/mol. IUPAC name: 4-[2-[2,3,5,6-tetramethyl-4-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine. InChIKey: IDJIUEOEJRHYRR-UHFFFAOYSA-N.
| Molecular formula | C24H20N2 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 4-[2-[2,3,5,6-tetramethyl-4-(2-pyridin-4-ylethynyl)phenyl]ethynyl]pyridine |
| InChIKey | IDJIUEOEJRHYRR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C#CC2=CC=NC=C2)C)C)C#CC3=CC=NC=C3)C |
Computed by PubChem (NCBI)