CAS 39122-38-8 appears in our catalog under these names: NSC 185058/ 99.83% (existing batch purity), NSC 185058–1, NSC 185058, NSC 185058 98%, N-(Pyridin-2-yl)pyridine-2-carbothioamide, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2,5g, 250mg.
N-pyridin-2-ylpyridine-2-carbothioamide (CAS 39122-38-8) is a chemical compound with the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. IUPAC name: N-pyridin-2-ylpyridine-2-carbothioamide. InChIKey: UGWOJXZJIZUKDP-UHFFFAOYSA-N.
| Molecular formula | C11H9N3S |
|---|---|
| Molecular weight | 215.28 g/mol |
| IUPAC name | N-pyridin-2-ylpyridine-2-carbothioamide |
| InChIKey | UGWOJXZJIZUKDP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=S)NC2=CC=CC=N2 |
Computed by PubChem (NCBI)