Products 36140-65-5
CAS 36140-65-5 appears in our catalog under these names: 5-[(2-Nitrophenyl)methylene]-2,4-thiazolidinedione, 5–((2–Nitrophenyl)methylidene)–1，3–thiazolidine–2，4–dione, NSC 55655/ 99.77% (existing batch purity), NSC 55655. Offered by: MedChemExpress, GLPBio, TargetMol, Chemat. Available pack sizes: 10 mg, 5 mg, 1 mg, 1mg, 5mg, 10mg, 25mg, 50mg.
5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 36140-65-5) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: AOOOVMMYAYKAGI-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 5-[(2-nitrophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | AOOOVMMYAYKAGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=C2C(=O)NC(=O)S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)