cas: 35657-36-4 — see every product listed under this CAS number, including other names
O-(4-Nitrobenzoyl)hydroxylamine 95% (CAS 35657-36-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A307666-250mg |
| cas | 35657-36-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 392.62 Pln | |
| Ambeed | 100g | 642.94 Pln | |
| Ambeed | 500g | 2740.00 Pln | |
| Ambeed | 1000g | 5404.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A307666 |
Amino 4-nitrobenzoate (CAS 35657-36-4) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: amino 4-nitrobenzoate. InChIKey: VTKRSTQMGNRMHL-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | amino 4-nitrobenzoate |
| InChIKey | VTKRSTQMGNRMHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)ON)[N+](=O)[O-] |
Computed by PubChem (NCBI)