cas: 2086-26-2 — see every product listed under this CAS number, including other names
O-(4-Nitrobenzyl)hydroxylamine hydrochloride, 97%, 97% (CAS 2086-26-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JSU-250mg |
| cas | 2086-26-2 |
| size | 250mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 789.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride (CAS 2086-26-2) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LKCAFSOYOMFQSL-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LKCAFSOYOMFQSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CON)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)