cas: 2086-26-2 — see every product listed under this CAS number, including other names
O-(4-Nitrobenzyl)hydroxylamine hydrochloride, 95% (CAS 2086-26-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F449154-5G |
| cas | 2086-26-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 1065.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride (CAS 2086-26-2) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LKCAFSOYOMFQSL-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LKCAFSOYOMFQSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CON)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)