cas: 2086-26-2 — see every product listed under this CAS number, including other names
O-(4-Nitrobenzyl)hydroxylamine (hydrochloride), 99.78% (CAS 2086-26-2) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10 g, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W012469-1 g |
| cas | 2086-26-2 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 287.18 Pln | |
| MedChemExpress | 10 g | 793.38 Pln | |
| MedChemExpress | 25 g | 1452.83 Pln | |
| MedChemExpress | 5 g | 551.89 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.78% |
O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride (CAS 2086-26-2) is a chemical compound with the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. IUPAC name: O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LKCAFSOYOMFQSL-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O3 |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | O-[(4-nitrophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LKCAFSOYOMFQSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CON)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)