cas: 77-09-8 — see every product listed under this CAS number, including other names
Phenolphthalein 99% (CAS 77-09-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A102510-10g |
| cas | 77-09-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 100g | 197.94 Pln | |
| Ambeed | 500g | 414.88 Pln | |
| Ambeed | 1000g | 648.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A102510 |
Phenolphthalein is a member of phenols. It is functionally related to a 2-benzofuran-1(3H)-one.
Source: ChEBI
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
| InChIKey | KJFMBFZCATUALV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)