cas: 77-09-8 — see every product listed under this CAS number, including other names
Phenolphthalein, 98%, 98.00% (CAS 77-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1kg, 250g, 500g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM05530E-100g |
| cas | 77-09-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 201.14 Pln | |
| Chemat | 1kg | 548.83 Pln | |
| Chemat | 250g | 262.44 Pln | |
| Chemat | 500g | 380.46 Pln | |
| Chemat | 50g | 145.77 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
Phenolphthalein is a member of phenols. It is functionally related to a 2-benzofuran-1(3H)-one.
Source: ChEBI
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
| InChIKey | KJFMBFZCATUALV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)