Phenylmalonic acid 97%
cas: 2613-89-0 — see every product listed under this CAS number, including other names
Phenylmalonic acid 97% (CAS 2613-89-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A820043-5g |
| cas | 2613-89-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 153.44 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 1221.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A820043 |
2-phenylpropanedioic acid (CAS 2613-89-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-phenylpropanedioic acid. InChIKey: WWYDYZMNFQIYPT-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-phenylpropanedioic acid |
| InChIKey | WWYDYZMNFQIYPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)