Propyl 4-methylbenzenesulfonate, 97%
cas: 599-91-7 — see every product listed under this CAS number, including other names
Propyl 4-methylbenzenesulfonate, 97% (CAS 599-91-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A148325-5g |
| cas | 599-91-7 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 542.81 Pln | |
| Ambeed | 500g | 1271.50 Pln | |
| Ambeed | 1kg | 1994.62 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 136.64 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 530.95 Pln | |
| BLDpharm | 500g | 1247.36 Pln | |
| BLDpharm | 1kg | 1952.67 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 285.20 Pln | |
| Chemat | 500g | 873.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Propyl 4-methylbenzenesulfonate (CAS 599-91-7) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propyl 4-methylbenzenesulfonate. InChIKey: JTTWNTXHFYNETH-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | propyl 4-methylbenzenesulfonate |
| InChIKey | JTTWNTXHFYNETH-UHFFFAOYSA-N |
| SMILES | CCCOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)
Synonyms:
Propyl p-toluenesulfonate, Propyl 4-methylbenzenesulfonate, Propyl tosylate, Propyl toluene-4-sulphonate, Benzenesulfonic acid, 4-methyl-, propyl ester, p-Toluenesulfonic acid, propyl ester, p-Toluenesulfonic acid n-propyl ester, propyl 4-methylbenzene-1-sulfonate, p-Toluenesulfonic Acid Propyl Ester, n-propyl p-toluenesulfonate
