cas: 599-91-7 — see every product listed under this CAS number, including other names
Propyl p-Toluenesulfonate, >98.0%(GC) (CAS 599-91-7) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0726-25ML |
| cas | 599-91-7 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 167.52 Pln | |
| TCI | 500ml | 1337.82 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Propyl 4-methylbenzenesulfonate (CAS 599-91-7) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propyl 4-methylbenzenesulfonate. InChIKey: JTTWNTXHFYNETH-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | propyl 4-methylbenzenesulfonate |
| InChIKey | JTTWNTXHFYNETH-UHFFFAOYSA-N |
| SMILES | CCCOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)