cas: 599-91-7 — see every product listed under this CAS number, including other names
Propyl 4-Methylbenzenesulfonate, 97%, 97% (CAS 599-91-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TZY-5g |
| cas | 599-91-7 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 294.80 Pln | |
| Chemat | 500g | 912.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Propyl 4-methylbenzenesulfonate (CAS 599-91-7) is a chemical compound with the molecular formula C10H14O3S and a molecular weight of 214.28 g/mol. IUPAC name: propyl 4-methylbenzenesulfonate. InChIKey: JTTWNTXHFYNETH-UHFFFAOYSA-N.
| Molecular formula | C10H14O3S |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | propyl 4-methylbenzenesulfonate |
| InChIKey | JTTWNTXHFYNETH-UHFFFAOYSA-N |
| SMILES | CCCOS(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)