Thiophen-3-amine xoxalate, 97%
cas: 861965-63-1 — see every product listed under this CAS number, including other names
Thiophen-3-amine xoxalate, 97% (CAS 861965-63-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A130548-1g |
| cas | 861965-63-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 820.94 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 169.96 Pln | |
| BLDpharm | 25g | 275.48 Pln | |
| BLDpharm | 100g | 880.83 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Oxalic acid;thiophen-3-amine (CAS 861965-63-1) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: oxalic acid;thiophen-3-amine. InChIKey: XBLAYFVCUPTTOI-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | oxalic acid;thiophen-3-amine |
| InChIKey | XBLAYFVCUPTTOI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)