cas: 88831-43-0 — see every product listed under this CAS number, including other names
methyl 3-amino-3-phenylpropanoate hydrochloride, 95% (CAS 88831-43-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F360672-100MG |
| cas | 88831-43-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1419.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-3-phenylpropanoate;hydrochloride (CAS 88831-43-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: methyl 3-amino-3-phenylpropanoate;hydrochloride. InChIKey: GYKTZBZYSKZYDB-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | methyl 3-amino-3-phenylpropanoate;hydrochloride |
| InChIKey | GYKTZBZYSKZYDB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)